C13H16O3 — CID 93037571
3-[[(2S)-oxan-2-yl]methoxy]benzaldehyde (PubChem CID 93037571) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-[[(2S)-oxan-2-yl]methoxy]benzaldehyde.
| Compound Name | 3-[[(2S)-oxan-2-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 93037571 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-[[(2S)-oxan-2-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1cccc(OC[C@@H]2CCCCO2)c1 |
| InChI | InChI=1S/C13H16O3/c14-9-11-4-3-6-12(8-11)16-10-13-5-1-2-7-15-13/h3-4,6,8-9,13H,1-2,5,7,10H2/t13-/m0/s1 |
| InChIKey | GMBMVNQXJIWSSN-ZDUSSCGKSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|