C13H16N2O4 — CID 63570861
5-[(3-formylphenoxy)methyl]oxolane-2-carbohydrazide (PubChem CID 63570861) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 5-[(3-formylphenoxy)methyl]oxolane-2-carbohydrazide.
| Compound Name | 5-[(3-formylphenoxy)methyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 63570861 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-[(3-formylphenoxy)methyl]oxolane-2-carbohydrazide |
| SMILES | NNC(=O)C1CCC(COc2cccc(C=O)c2)O1 |
| InChI | InChI=1S/C13H16N2O4/c14-15-13(17)12-5-4-11(19-12)8-18-10-3-1-2-9(6-10)7-16/h1-3,6-7,11-12H,4-5,8,14H2,(H,15,17) |
| InChIKey | ZUYLIMRMWYNPAI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|