C22H31NO4 — CID 45220553
N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]oxolane-2-carboxamide (PubChem CID 45220553) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]oxolane-2-carboxamide.
| Compound Name | N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 45220553 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]oxolane-2-carboxamide |
| SMILES | CC1(COc2cccc(CN(C(=O)C3CCCO3)C3CCCC3)c2)COC1 |
| InChI | InChI=1S/C22H31NO4/c1-22(14-25-15-22)16-27-19-9-4-6-17(12-19)13-23(18-7-2-3-8-18)21(24)20-10-5-11-26-20/h4,6,9,12,18,20H,2-3,5,7-8,10-11,13-16H2,1H3 |
| InChIKey | CAVUGBAXVVAPCT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |