About (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide
(2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide (PubChem CID 99859409) has the molecular formula C15H17F2NO2
and a molecular weight of 281.30 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide |
| PubChem CID | 99859409 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide |
| SMILES | O=C([C@H]1CCCO1)N(Cc1c(F)cccc1F)C1CC1 |
| InChI | InChI=1S/C15H17F2NO2/c16-12-3-1-4-13(17)11(12)9-18(10-6-7-10)15(19)14-5-2-8-20-14/h1,3-4,10,14H,2,5-9H2/t14-/m1/s1 |
| InChIKey | VLLHDJRFFMTCPX-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide?
The IUPAC name of (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide (CID 99859409) is (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide.
What is the SMILES notation for (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide?
The canonical SMILES for (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide is O=C([C@H]1CCCO1)N(Cc1c(F)cccc1F)C1CC1.
What is the InChIKey of (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide?
The InChIKey is VLLHDJRFFMTCPX-CQSZACIVSA-N. The full InChI is InChI=1S/C15H17F2NO2/c16-12-3-1-4-13(17)11(12)9-18(10-6-7-10)15(19)14-5-2-8-20-14/h1,3-4,10,14H,2,5-9H2/t14-/m1/s1.
What are the key properties of (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide?
(2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide has a molecular weight of 281.30 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-cyclopropyl-N-[(2,6-difluorophenyl)methyl]oxolane-2-carboxamide is sourced from PubChem (CID 99859409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).