C11H10F2O2 — CID 65331301
(2,6-difluorophenyl)-(oxolan-2-yl)methanone (PubChem CID 65331301) has the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(oxolan-2-yl)methanone.
| Compound Name | (2,6-difluorophenyl)-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 65331301 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (2,6-difluorophenyl)-(oxolan-2-yl)methanone |
| SMILES | O=C(c1c(F)cccc1F)C1CCCO1 |
| InChI | InChI=1S/C11H10F2O2/c12-7-3-1-4-8(13)10(7)11(14)9-5-2-6-15-9/h1,3-4,9H,2,5-6H2 |
| InChIKey | VUQPIUZEXHQGLY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |