C11H10F2O3 — CID 66570616
1-(2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone (PubChem CID 66570616) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone.
| Compound Name | 1-(2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 66570616 |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone |
| SMILES | O=C(CC1OCCO1)c1c(F)cccc1F |
| InChI | InChI=1S/C11H10F2O3/c12-7-2-1-3-8(13)11(7)9(14)6-10-15-4-5-16-10/h1-3,10H,4-6H2 |
| InChIKey | COJVVNASIDEXJG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |