C11H8F2O2 — CID 102651034
(2,6-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanone (PubChem CID 102651034) has the molecular formula C11H8F2O2 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanone.
| Compound Name | (2,6-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanone |
|---|---|
| PubChem CID | 102651034 |
| Molecular Formula | C11H8F2O2 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (2,6-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanone |
| SMILES | O=C(C1=CCCO1)c1c(F)cccc1F |
| InChI | InChI=1S/C11H8F2O2/c12-7-3-1-4-8(13)10(7)11(14)9-5-2-6-15-9/h1,3-5H,2,6H2 |
| InChIKey | HVGMERQQEUNQRO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |