C13H12F2O — CID 62078294
cyclohexen-1-yl-(2,6-difluorophenyl)methanone (PubChem CID 62078294) has the molecular formula C13H12F2O and a molecular weight of 222.23 g/mol. Its IUPAC name is cyclohexen-1-yl-(2,6-difluorophenyl)methanone.
| Compound Name | cyclohexen-1-yl-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 62078294 |
| Molecular Formula | C13H12F2O |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | cyclohexen-1-yl-(2,6-difluorophenyl)methanone |
| SMILES | O=C(C1=CCCCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H12F2O/c14-10-7-4-8-11(15)12(10)13(16)9-5-2-1-3-6-9/h4-5,7-8H,1-3,6H2 |
| InChIKey | MZZYNRPORTXALF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |