C13H9F5O — CID 62080486
cyclohexen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 62080486) has the molecular formula C13H9F5O and a molecular weight of 276.20 g/mol. Its IUPAC name is cyclohexen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | cyclohexen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 62080486 |
| Molecular Formula | C13H9F5O |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | cyclohexen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(C1=CCCCC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H9F5O/c14-8-7(9(15)11(17)12(18)10(8)16)13(19)6-4-2-1-3-5-6/h4H,1-3,5H2 |
| InChIKey | FSJZWJKBNOETDW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|