C16H20O — CID 103449982
cyclohexen-1-yl-(2,4,5-trimethylphenyl)methanone (PubChem CID 103449982) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is cyclohexen-1-yl-(2,4,5-trimethylphenyl)methanone.
| Compound Name | cyclohexen-1-yl-(2,4,5-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 103449982 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | cyclohexen-1-yl-(2,4,5-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)C2=CCCCC2)cc1C |
| InChI | InChI=1S/C16H20O/c1-11-9-13(3)15(10-12(11)2)16(17)14-7-5-4-6-8-14/h7,9-10H,4-6,8H2,1-3H3 |
| InChIKey | QIEQIQBDMOBZCF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |