C14H16O — CID 62080312
cyclopenten-1-yl-(2,3-dimethylphenyl)methanone (PubChem CID 62080312) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is cyclopenten-1-yl-(2,3-dimethylphenyl)methanone.
| Compound Name | cyclopenten-1-yl-(2,3-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 62080312 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | cyclopenten-1-yl-(2,3-dimethylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)C2=CCCC2)c1C |
| InChI | InChI=1S/C14H16O/c1-10-6-5-9-13(11(10)2)14(15)12-7-3-4-8-12/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | NYSXOICHAACDJJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |