C9H12O2 — CID 68719323
1-(cyclohexen-1-yl)propane-1,2-dione (PubChem CID 68719323) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)propane-1,2-dione.
| Compound Name | 1-(cyclohexen-1-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 68719323 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-(cyclohexen-1-yl)propane-1,2-dione |
| SMILES | CC(=O)C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
| InChIKey | FNGHXXRZKJHCIO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|