About cyclohexene-1-carboxamide;ethane;molecular hydrogen
cyclohexene-1-carboxamide;ethane;molecular hydrogen (PubChem CID 162375470) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is cyclohexene-1-carboxamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | cyclohexene-1-carboxamide;ethane;molecular hydrogen |
| PubChem CID | 162375470 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | cyclohexene-1-carboxamide;ethane;molecular hydrogen |
| SMILES | CC.NC(=O)C1=CCCCC1.[H][H] |
| InChI | InChI=1S/C7H11NO.C2H6.H2/c8-7(9)6-4-2-1-3-5-6;1-2;/h4H,1-3,5H2,(H2,8,9);1-2H3;1H |
| InChIKey | GWFQVJZTWTXGTM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexene-1-carboxamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene-1-carboxamide;ethane;molecular hydrogen?
The IUPAC name of cyclohexene-1-carboxamide;ethane;molecular hydrogen (CID 162375470) is cyclohexene-1-carboxamide;ethane;molecular hydrogen.
What is the SMILES notation for cyclohexene-1-carboxamide;ethane;molecular hydrogen?
The canonical SMILES for cyclohexene-1-carboxamide;ethane;molecular hydrogen is CC.NC(=O)C1=CCCCC1.[H][H].
What is the InChIKey of cyclohexene-1-carboxamide;ethane;molecular hydrogen?
The InChIKey is GWFQVJZTWTXGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.C2H6.H2/c8-7(9)6-4-2-1-3-5-6;1-2;/h4H,1-3,5H2,(H2,8,9);1-2H3;1H.
What are the key properties of cyclohexene-1-carboxamide;ethane;molecular hydrogen?
cyclohexene-1-carboxamide;ethane;molecular hydrogen has a molecular weight of 157.26 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene-1-carboxamide;ethane;molecular hydrogen is sourced from PubChem (CID 162375470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).