C12H21NO — CID 106655718
2-amino-1-(cyclohexen-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 106655718) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-amino-1-(cyclohexen-1-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 2-amino-1-(cyclohexen-1-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 106655718 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-amino-1-(cyclohexen-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)C(N)C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C12H21NO/c1-12(2,3)11(13)10(14)9-7-5-4-6-8-9/h7,11H,4-6,8,13H2,1-3H3 |
| InChIKey | OCMPVONEBYSAEW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |