C14H24O — CID 130677283
1-(cyclohexen-1-yl)-2,2,3,3-tetramethylbutan-1-one (PubChem CID 130677283) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-2,2,3,3-tetramethylbutan-1-one.
| Compound Name | 1-(cyclohexen-1-yl)-2,2,3,3-tetramethylbutan-1-one |
|---|---|
| PubChem CID | 130677283 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-(cyclohexen-1-yl)-2,2,3,3-tetramethylbutan-1-one |
| SMILES | CC(C)(C)C(C)(C)C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C14H24O/c1-13(2,3)14(4,5)12(15)11-9-7-6-8-10-11/h9H,6-8,10H2,1-5H3 |
| InChIKey | CQRGHSOJDSPEEW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |