C9H15NO — CID 11019067
N,N-dimethylcyclohexene-1-carboxamide (PubChem CID 11019067) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N,N-dimethylcyclohexene-1-carboxamide.
| Compound Name | N,N-dimethylcyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 11019067 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N,N-dimethylcyclohexene-1-carboxamide |
| SMILES | CN(C)C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C9H15NO/c1-10(2)9(11)8-6-4-3-5-7-8/h6H,3-5,7H2,1-2H3 |
| InChIKey | SELVQTFMZLARSL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |