C18H24O — CID 106651815
1-[(1E)-cycloocten-1-yl]-2-methyl-2-phenylpropan-1-one (PubChem CID 106651815) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-[(1E)-cycloocten-1-yl]-2-methyl-2-phenylpropan-1-one.
| Compound Name | 1-[(1E)-cycloocten-1-yl]-2-methyl-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 106651815 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[(1E)-cycloocten-1-yl]-2-methyl-2-phenylpropan-1-one |
| SMILES | CC(C)(C(=O)/C1=C/CCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H24O/c1-18(2,16-13-9-6-10-14-16)17(19)15-11-7-4-3-5-8-12-15/h6,9-11,13-14H,3-5,7-8,12H2,1-2H3/b15-11+ |
| InChIKey | RFMULKCSQRNJDV-RVDMUPIBSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |