C19H26O — CID 106651828
1-(cyclohepten-1-yl)-2-ethyl-2-phenylbutan-1-one (PubChem CID 106651828) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-ethyl-2-phenylbutan-1-one.
| Compound Name | 1-(cyclohepten-1-yl)-2-ethyl-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 106651828 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-ethyl-2-phenylbutan-1-one |
| SMILES | CCC(CC)(C(=O)C1=CCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H26O/c1-3-19(4-2,17-14-10-7-11-15-17)18(20)16-12-8-5-6-9-13-16/h7,10-12,14-15H,3-6,8-9,13H2,1-2H3 |
| InChIKey | GFFJXZRYAAKIHE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |