C18H24O2 — CID 67914178
2-(cyclohexen-1-yl)-1,2-di(cyclopenten-1-yl)-2-hydroxyethanone (PubChem CID 67914178) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1,2-di(cyclopenten-1-yl)-2-hydroxyethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1,2-di(cyclopenten-1-yl)-2-hydroxyethanone |
|---|---|
| PubChem CID | 67914178 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1,2-di(cyclopenten-1-yl)-2-hydroxyethanone |
| SMILES | O=C(C1=CCCC1)C(O)(C1=CCCC1)C1=CCCCC1 |
| InChI | InChI=1S/C18H24O2/c19-17(14-8-4-5-9-14)18(20,16-12-6-7-13-16)15-10-2-1-3-11-15/h8,10,12,20H,1-7,9,11,13H2 |
| InChIKey | MQCPEYDREOBSMF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|