C12H19Cl — CID 10997998
1-[(Z)-1-chloro-3,3-dimethylbut-1-enyl]cyclohexene (PubChem CID 10997998) has the molecular formula C12H19Cl and a molecular weight of 198.74 g/mol. Its IUPAC name is 1-[(Z)-1-chloro-3,3-dimethylbut-1-enyl]cyclohexene.
| Compound Name | 1-[(Z)-1-chloro-3,3-dimethylbut-1-enyl]cyclohexene |
|---|---|
| PubChem CID | 10997998 |
| Molecular Formula | C12H19Cl |
| Molecular Weight | 198.74 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-[(Z)-1-chloro-3,3-dimethylbut-1-enyl]cyclohexene |
| SMILES | CC(C)(C)/C=C(\Cl)C1=CCCCC1 |
| InChI | InChI=1S/C12H19Cl/c1-12(2,3)9-11(13)10-7-5-4-6-8-10/h7,9H,4-6,8H2,1-3H3/b11-9- |
| InChIKey | LVCHSXQJJSDKAJ-LUAWRHEFSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |