C14H22O — CID 140525623
2-(cyclohexen-1-yl)-3,4,4-trimethylpent-2-enal (PubChem CID 140525623) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-3,4,4-trimethylpent-2-enal.
| Compound Name | 2-(cyclohexen-1-yl)-3,4,4-trimethylpent-2-enal |
|---|---|
| PubChem CID | 140525623 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-(cyclohexen-1-yl)-3,4,4-trimethylpent-2-enal |
| SMILES | CC(=C(C=O)C1=CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C14H22O/c1-11(14(2,3)4)13(10-15)12-8-6-5-7-9-12/h8,10H,5-7,9H2,1-4H3 |
| InChIKey | IFBLQKALVINCBA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|