acetic acid;cyclohexene-1-carbaldehyde

C9H14O3 — CID 175385909

IUPACacetic acid;cyclohexene-1-carbaldehyde
SMILESCC(=O)O.O=CC1=CCCCC1
InChIInChI=1S/C7H10O.C2H4O2/c8-6-7-4-2-1-3-5-7;1-2(3)4/h4,6H,1-3,5H2;1H3,(H,3,4)
InChIKeyFJASWGYPMQFWMN-UHFFFAOYSA-N
MW170.21 g/mol
LogP1.78
Rot. Bonds1

About acetic acid;cyclohexene-1-carbaldehyde

acetic acid;cyclohexene-1-carbaldehyde (PubChem CID 175385909) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is acetic acid;cyclohexene-1-carbaldehyde.

Molecular Properties

Compound Nameacetic acid;cyclohexene-1-carbaldehyde
PubChem CID175385909
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Nameacetic acid;cyclohexene-1-carbaldehyde
SMILESCC(=O)O.O=CC1=CCCCC1
InChIInChI=1S/C7H10O.C2H4O2/c8-6-7-4-2-1-3-5-7;1-2(3)4/h4,6H,1-3,5H2;1H3,(H,3,4)
InChIKeyFJASWGYPMQFWMN-UHFFFAOYSA-N
XLogP1.78
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze acetic acid;cyclohexene-1-carbaldehyde with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;cyclohexene-1-carbaldehyde?
The IUPAC name of acetic acid;cyclohexene-1-carbaldehyde (CID 175385909) is acetic acid;cyclohexene-1-carbaldehyde.
What is the SMILES notation for acetic acid;cyclohexene-1-carbaldehyde?
The canonical SMILES for acetic acid;cyclohexene-1-carbaldehyde is CC(=O)O.O=CC1=CCCCC1.
What is the InChIKey of acetic acid;cyclohexene-1-carbaldehyde?
The InChIKey is FJASWGYPMQFWMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C2H4O2/c8-6-7-4-2-1-3-5-7;1-2(3)4/h4,6H,1-3,5H2;1H3,(H,3,4).
What are the key properties of acetic acid;cyclohexene-1-carbaldehyde?
acetic acid;cyclohexene-1-carbaldehyde has a molecular weight of 170.21 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;cyclohexene-1-carbaldehyde is sourced from PubChem (CID 175385909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).