C19H26O — CID 70617483
(1Z,4Z)-1,5-di(cyclohexen-1-yl)-2,4-dimethylpenta-1,4-dien-3-one (PubChem CID 70617483) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (1Z,4Z)-1,5-di(cyclohexen-1-yl)-2,4-dimethylpenta-1,4-dien-3-one.
| Compound Name | (1Z,4Z)-1,5-di(cyclohexen-1-yl)-2,4-dimethylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 70617483 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (1Z,4Z)-1,5-di(cyclohexen-1-yl)-2,4-dimethylpenta-1,4-dien-3-one |
| SMILES | C/C(=C/C1=CCCCC1)C(=O)/C(C)=C\C1=CCCCC1 |
| InChI | InChI=1S/C19H26O/c1-15(13-17-9-5-3-6-10-17)19(20)16(2)14-18-11-7-4-8-12-18/h9,11,13-14H,3-8,10,12H2,1-2H3/b15-13-,16-14- |
| InChIKey | FFJDJUIZVWPRDH-VMNXYWKNSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|