C10H17N — CID 71333973
2-(cyclohexen-1-yl)-N,N-dimethylethenamine (PubChem CID 71333973) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N,N-dimethylethenamine.
| Compound Name | 2-(cyclohexen-1-yl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 71333973 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N,N-dimethylethenamine |
| SMILES | CN(C)C=CC1=CCCCC1 |
| InChI | InChI=1S/C10H17N/c1-11(2)9-8-10-6-4-3-5-7-10/h6,8-9H,3-5,7H2,1-2H3 |
| InChIKey | XXAZUYWPYVUSPK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |