C11H17N — CID 13143551
1-(cyclohexen-1-yl)-N-[(E)-prop-1-enyl]ethanimine (PubChem CID 13143551) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-[(E)-prop-1-enyl]ethanimine.
| Compound Name | 1-(cyclohexen-1-yl)-N-[(E)-prop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 13143551 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-[(E)-prop-1-enyl]ethanimine |
| SMILES | C/C=C/N=C(\C)C1=CCCCC1 |
| InChI | InChI=1S/C11H17N/c1-3-9-12-10(2)11-7-5-4-6-8-11/h3,7,9H,4-6,8H2,1-2H3/b9-3+,12-10+ |
| InChIKey | UQHIJLZFFBMSMG-VNBACUINSA-N |
| XLogP | 3.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|