C15H23N — CID 134288156
(2Z,5Z)-2-(cyclohexen-1-yl)-3-methyl-4-methylidenehepta-2,5-dien-1-amine (PubChem CID 134288156) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (2Z,5Z)-2-(cyclohexen-1-yl)-3-methyl-4-methylidenehepta-2,5-dien-1-amine.
| Compound Name | (2Z,5Z)-2-(cyclohexen-1-yl)-3-methyl-4-methylidenehepta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 134288156 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2Z,5Z)-2-(cyclohexen-1-yl)-3-methyl-4-methylidenehepta-2,5-dien-1-amine |
| SMILES | C=C(/C=C\C)/C(C)=C(\CN)C1=CCCCC1 |
| InChI | InChI=1S/C15H23N/c1-4-8-12(2)13(3)15(11-16)14-9-6-5-7-10-14/h4,8-9H,2,5-7,10-11,16H2,1,3H3/b8-4-,15-13+ |
| InChIKey | QAYYYFUQZTUTSK-QNJKFRJWSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|