C11H16 — CID 11994847
1-penta-1,2-dien-3-ylcyclohexene (PubChem CID 11994847) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 1-penta-1,2-dien-3-ylcyclohexene.
| Compound Name | 1-penta-1,2-dien-3-ylcyclohexene |
|---|---|
| PubChem CID | 11994847 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1-penta-1,2-dien-3-ylcyclohexene |
| SMILES | C=C=C(CC)C1=CCCCC1 |
| InChI | InChI=1S/C11H16/c1-3-10(4-2)11-8-6-5-7-9-11/h8H,1,4-7,9H2,2H3 |
| InChIKey | USWAYVVRADWEMF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |