C11H16 — CID 142934932
1-(2-methylbuta-2,3-dienyl)cyclohexene (PubChem CID 142934932) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 1-(2-methylbuta-2,3-dienyl)cyclohexene.
| Compound Name | 1-(2-methylbuta-2,3-dienyl)cyclohexene |
|---|---|
| PubChem CID | 142934932 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1-(2-methylbuta-2,3-dienyl)cyclohexene |
| SMILES | C=C=C(C)CC1=CCCCC1 |
| InChI | InChI=1S/C11H16/c1-3-10(2)9-11-7-5-4-6-8-11/h7H,1,4-6,8-9H2,2H3 |
| InChIKey | VGVLKSFIEWZFCK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|