C23H28N2 — CID 135199090
1-(cyclohexen-1-yl)-N-[(1Z)-1-[3-methyl-6-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]buta-1,3-dienyl]ethanimine (PubChem CID 135199090) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-[(1Z)-1-[3-methyl-6-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]buta-1,3-dienyl]ethanimine.
| Compound Name | 1-(cyclohexen-1-yl)-N-[(1Z)-1-[3-methyl-6-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 135199090 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-[(1Z)-1-[3-methyl-6-[(3E)-penta-1,3-dien-3-yl]-2-pyridinyl]buta-1,3-dienyl]ethanimine |
| SMILES | C=C/C=C(\N=C(/C)C1=CCCCC1)c1nc(/C(C=C)=C/C)ccc1C |
| InChI | InChI=1S/C23H28N2/c1-6-12-22(24-18(5)20-13-10-9-11-14-20)23-17(4)15-16-21(25-23)19(7-2)8-3/h6-8,12-13,15-16H,1-2,9-11,14H2,3-5H3/b19-8+,22-12-,24-18+ |
| InChIKey | HJKJFKOCSPMLCF-GPNGVDPDSA-N |
| XLogP | 6.47 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|