C8H11N — CID 7953
2,4,6-trimethylpyridine (PubChem CID 7953) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 2,4,6-trimethylpyridine.
| Compound Name | 2,4,6-trimethylpyridine |
|---|---|
| PubChem CID | 7953 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 2,4,6-trimethylpyridine |
| SMILES | Cc1cc(C)nc(C)c1 |
| InChI | InChI=1S/C8H11N/c1-6-4-7(2)9-8(3)5-6/h4-5H,1-3H3 |
| InChIKey | BWZVCCNYKMEVEX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |