About 2,5-dimethylpyridine
2,5-dimethylpyridine (PubChem CID 11526) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is 2,5-dimethylpyridine.
Molecular Properties
| Compound Name | 2,5-dimethylpyridine |
| PubChem CID | 11526 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 2,5-dimethylpyridine |
| SMILES | Cc1ccc(C)nc1 |
| InChI | InChI=1S/C7H9N/c1-6-3-4-7(2)8-5-6/h3-5H,1-2H3 |
| InChIKey | XWKFPIODWVPXLX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylpyridine?
The IUPAC name of 2,5-dimethylpyridine (CID 11526) is 2,5-dimethylpyridine.
What is the SMILES notation for 2,5-dimethylpyridine?
The canonical SMILES for 2,5-dimethylpyridine is Cc1ccc(C)nc1.
What is the InChIKey of 2,5-dimethylpyridine?
The InChIKey is XWKFPIODWVPXLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N/c1-6-3-4-7(2)8-5-6/h3-5H,1-2H3.
What are the key properties of 2,5-dimethylpyridine?
2,5-dimethylpyridine has a molecular weight of 107.16 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylpyridine is sourced from PubChem (CID 11526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).