About 2,2'-Bipyridine
2,2'-Bipyridine (PubChem CID 1474) has the molecular formula C10H8N2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 2,2'-Bipyridine |
| PubChem CID | 1474 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-pyridin-2-ylpyridine |
| SMILES | C1=CC=NC(=C1)C2=CC=CC=N2 |
| InChI | InChI=1S/C10H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-8H |
| InChIKey | ROFVEXUMMXZLPA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 25.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 120 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2'-Bipyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'-Bipyridine?
The IUPAC name of 2,2'-Bipyridine (CID 1474) is 2-pyridin-2-ylpyridine.
What is the SMILES notation for 2,2'-Bipyridine?
The canonical SMILES for 2,2'-Bipyridine is C1=CC=NC(=C1)C2=CC=CC=N2.
What is the InChIKey of 2,2'-Bipyridine?
The InChIKey is ROFVEXUMMXZLPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-8H.
What are the key properties of 2,2'-Bipyridine?
2,2'-Bipyridine has a molecular weight of 156.18 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'-Bipyridine is sourced from PubChem (CID 1474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).