About quinoxaline
quinoxaline (PubChem CID 7045) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is quinoxaline.
Molecular Properties
| Compound Name | quinoxaline |
| PubChem CID | 7045 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | quinoxaline |
| SMILES | c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-6H |
| InChIKey | XSCHRSMBECNVNS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxaline?
The IUPAC name of quinoxaline (CID 7045) is quinoxaline.
What is the SMILES notation for quinoxaline?
The canonical SMILES for quinoxaline is c1ccc2nccnc2c1.
What is the InChIKey of quinoxaline?
The InChIKey is XSCHRSMBECNVNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-6H.
What are the key properties of quinoxaline?
quinoxaline has a molecular weight of 130.15 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxaline is sourced from PubChem (CID 7045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).