About 2,3-dichloroquinoxaline
2,3-dichloroquinoxaline (PubChem CID 16659) has the molecular formula C8H4Cl2N2
and a molecular weight of 199.04 g/mol. Its IUPAC name is 2,3-dichloroquinoxaline.
Molecular Properties
| Compound Name | 2,3-dichloroquinoxaline |
| PubChem CID | 16659 |
| Molecular Formula | C8H4Cl2N2 |
| Molecular Weight | 199.04 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 2,3-dichloroquinoxaline |
| SMILES | Clc1nc2ccccc2nc1Cl |
| InChI | InChI=1S/C8H4Cl2N2/c9-7-8(10)12-6-4-2-1-3-5(6)11-7/h1-4H |
| InChIKey | SPSSDDOTEZKOOV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.04 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dichloroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloroquinoxaline?
The IUPAC name of 2,3-dichloroquinoxaline (CID 16659) is 2,3-dichloroquinoxaline.
What is the SMILES notation for 2,3-dichloroquinoxaline?
The canonical SMILES for 2,3-dichloroquinoxaline is Clc1nc2ccccc2nc1Cl.
What is the InChIKey of 2,3-dichloroquinoxaline?
The InChIKey is SPSSDDOTEZKOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2/c9-7-8(10)12-6-4-2-1-3-5(6)11-7/h1-4H.
What are the key properties of 2,3-dichloroquinoxaline?
2,3-dichloroquinoxaline has a molecular weight of 199.04 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloroquinoxaline is sourced from PubChem (CID 16659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).