About phenazine
phenazine (PubChem CID 4757) has the molecular formula C12H8N2
and a molecular weight of 180.21 g/mol. Its IUPAC name is phenazine.
Molecular Properties
| Compound Name | phenazine |
| PubChem CID | 4757 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | phenazine |
| SMILES | c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H8N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H |
| InChIKey | PCNDJXKNXGMECE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine?
The IUPAC name of phenazine (CID 4757) is phenazine.
What is the SMILES notation for phenazine?
The canonical SMILES for phenazine is c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of phenazine?
The InChIKey is PCNDJXKNXGMECE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H.
What are the key properties of phenazine?
phenazine has a molecular weight of 180.21 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine is sourced from PubChem (CID 4757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).