C19H17F2NO — CID 143518363
N-[4-(cyclohexen-1-yl)phenyl]-2,6-difluorobenzamide (PubChem CID 143518363) has the molecular formula C19H17F2NO and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[4-(cyclohexen-1-yl)phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[4-(cyclohexen-1-yl)phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 143518363 |
| Molecular Formula | C19H17F2NO |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[4-(cyclohexen-1-yl)phenyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(C2=CCCCC2)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H17F2NO/c20-16-7-4-8-17(21)18(16)19(23)22-15-11-9-14(10-12-15)13-5-2-1-3-6-13/h4-5,7-12H,1-3,6H2,(H,22,23) |
| InChIKey | JUTPZRBFLJHKDB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |