C16H17F2NO — CID 143234800
2,6-difluoro-N-(4-methylphenyl)benzamide;ethane (PubChem CID 143234800) has the molecular formula C16H17F2NO and a molecular weight of 277.31 g/mol. Its IUPAC name is 2,6-difluoro-N-(4-methylphenyl)benzamide;ethane.
| Compound Name | 2,6-difluoro-N-(4-methylphenyl)benzamide;ethane |
|---|---|
| PubChem CID | 143234800 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2,6-difluoro-N-(4-methylphenyl)benzamide;ethane |
| SMILES | CC.Cc1ccc(NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C14H11F2NO.C2H6/c1-9-5-7-10(8-6-9)17-14(18)13-11(15)3-2-4-12(13)16;1-2/h2-8H,1H3,(H,17,18);1-2H3 |
| InChIKey | PIQMEZFGQBORQU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |