C19H19F2NO — CID 58110509
2,6-difluoro-N-[4-[(E)-3-methylpent-2-en-2-yl]phenyl]benzamide (PubChem CID 58110509) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-[(E)-3-methylpent-2-en-2-yl]phenyl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-[(E)-3-methylpent-2-en-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58110509 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2,6-difluoro-N-[4-[(E)-3-methylpent-2-en-2-yl]phenyl]benzamide |
| SMILES | CC/C(C)=C(\C)c1ccc(NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C19H19F2NO/c1-4-12(2)13(3)14-8-10-15(11-9-14)22-19(23)18-16(20)6-5-7-17(18)21/h5-11H,4H2,1-3H3,(H,22,23)/b13-12+ |
| InChIKey | ACHHECOVXQTRNJ-OUKQBFOZSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |