C19H17F2NO3 — CID 58992446
[(E)-3-[4-[(2,6-difluorobenzoyl)amino]phenyl]but-2-en-2-yl] acetate (PubChem CID 58992446) has the molecular formula C19H17F2NO3 and a molecular weight of 345.35 g/mol. Its IUPAC name is [(E)-3-[4-[(2,6-difluorobenzoyl)amino]phenyl]but-2-en-2-yl] acetate.
| Compound Name | [(E)-3-[4-[(2,6-difluorobenzoyl)amino]phenyl]but-2-en-2-yl] acetate |
|---|---|
| PubChem CID | 58992446 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [(E)-3-[4-[(2,6-difluorobenzoyl)amino]phenyl]but-2-en-2-yl] acetate |
| SMILES | CC(=O)O/C(C)=C(\C)c1ccc(NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C19H17F2NO3/c1-11(12(2)25-13(3)23)14-7-9-15(10-8-14)22-19(24)18-16(20)5-4-6-17(18)21/h4-10H,1-3H3,(H,22,24)/b12-11+ |
| InChIKey | GRJJIZYHYKJZIE-VAWYXSNFSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|