C19H11Cl2F2NO — CID 11222663
N-[4-(2,5-dichlorophenyl)phenyl]-2,6-difluorobenzamide (PubChem CID 11222663) has the molecular formula C19H11Cl2F2NO and a molecular weight of 378.21 g/mol. Its IUPAC name is N-[4-(2,5-dichlorophenyl)phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[4-(2,5-dichlorophenyl)phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 11222663 |
| Molecular Formula | C19H11Cl2F2NO |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | N-[4-(2,5-dichlorophenyl)phenyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2cc(Cl)ccc2Cl)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H11Cl2F2NO/c20-12-6-9-15(21)14(10-12)11-4-7-13(8-5-11)24-19(25)18-16(22)2-1-3-17(18)23/h1-10H,(H,24,25) |
| InChIKey | JDRVPORPMVPGLD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |