C20H11ClF2N2O2 — CID 54596606
N-[4-(5-chloro-1,3-benzoxazol-6-yl)phenyl]-2,6-difluorobenzamide (PubChem CID 54596606) has the molecular formula C20H11ClF2N2O2 and a molecular weight of 384.77 g/mol. Its IUPAC name is N-[4-(5-chloro-1,3-benzoxazol-6-yl)phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[4-(5-chloro-1,3-benzoxazol-6-yl)phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 54596606 |
| Molecular Formula | C20H11ClF2N2O2 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[4-(5-chloro-1,3-benzoxazol-6-yl)phenyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2cc3ocnc3cc2Cl)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H11ClF2N2O2/c21-14-9-17-18(27-10-24-17)8-13(14)11-4-6-12(7-5-11)25-20(26)19-15(22)2-1-3-16(19)23/h1-10H,(H,25,26) |
| InChIKey | PVMKBNFKQHDCCJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |