About N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride
N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride (PubChem CID 73052207) has the molecular formula C19H14Cl2F2N2O2
and a molecular weight of 411.24 g/mol. Its IUPAC name is N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride.
Molecular Properties
| Compound Name | N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride |
| PubChem CID | 73052207 |
| Molecular Formula | C19H14Cl2F2N2O2 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride |
| SMILES | COc1ncc(Cl)cc1-c1ccc(NC(=O)c2c(F)cccc2F)cc1.Cl |
| InChI | InChI=1S/C19H13ClF2N2O2.ClH/c1-26-19-14(9-12(20)10-23-19)11-5-7-13(8-6-11)24-18(25)17-15(21)3-2-4-16(17)22;/h2-10H,1H3,(H,24,25);1H |
| InChIKey | FPRMTCMLDBTHHU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride?
The IUPAC name of N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride (CID 73052207) is N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride.
What is the SMILES notation for N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride?
The canonical SMILES for N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride is COc1ncc(Cl)cc1-c1ccc(NC(=O)c2c(F)cccc2F)cc1.Cl.
What is the InChIKey of N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride?
The InChIKey is FPRMTCMLDBTHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClF2N2O2.ClH/c1-26-19-14(9-12(20)10-23-19)11-5-7-13(8-6-11)24-18(25)17-15(21)3-2-4-16(17)22;/h2-10H,1H3,(H,24,25);1H.
What are the key properties of N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride?
N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride has a molecular weight of 411.24 g/mol, XLogP of 5.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5-chloro-2-methoxy-3-pyridinyl)phenyl]-2,6-difluorobenzamide;hydrochloride is sourced from PubChem (CID 73052207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).