C14H9ClN2O2 — CID 110765115
N-(4-chlorophenyl)-1,3-benzoxazole-6-carboxamide (PubChem CID 110765115) has the molecular formula C14H9ClN2O2 and a molecular weight of 272.69 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110765115 |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(4-chlorophenyl)-1,3-benzoxazole-6-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C14H9ClN2O2/c15-10-2-4-11(5-3-10)17-14(18)9-1-6-12-13(7-9)19-8-16-12/h1-8H,(H,17,18) |
| InChIKey | ACPLCXIQITVDNG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |