C21H11F3N2O3 — CID 90081311
N-[3-(1,3-benzoxazole-6-carbonyl)-4,5-difluorophenyl]-3-fluorobenzamide (PubChem CID 90081311) has the molecular formula C21H11F3N2O3 and a molecular weight of 396.32 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazole-6-carbonyl)-4,5-difluorophenyl]-3-fluorobenzamide.
| Compound Name | N-[3-(1,3-benzoxazole-6-carbonyl)-4,5-difluorophenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 90081311 |
| Molecular Formula | C21H11F3N2O3 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-[3-(1,3-benzoxazole-6-carbonyl)-4,5-difluorophenyl]-3-fluorobenzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(C(=O)c2ccc3ncoc3c2)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H11F3N2O3/c22-13-3-1-2-12(6-13)21(28)26-14-8-15(19(24)16(23)9-14)20(27)11-4-5-17-18(7-11)29-10-25-17/h1-10H,(H,26,28) |
| InChIKey | XTKIXEHQVYSBAX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |