About 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide
2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide (PubChem CID 24875776) has the molecular formula C20H12F2N2O2S
and a molecular weight of 382.39 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide.
Molecular Properties
| Compound Name | 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide |
| PubChem CID | 24875776 |
| Molecular Formula | C20H12F2N2O2S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2csc(-c3ncco3)c2)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H12F2N2O2S/c21-15-2-1-3-16(22)18(15)19(25)24-14-6-4-12(5-7-14)13-10-17(27-11-13)20-23-8-9-26-20/h1-11H,(H,24,25) |
| InChIKey | ONUMOWYRZRJYOK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide?
The IUPAC name of 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide (CID 24875776) is 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide.
What is the SMILES notation for 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide?
The canonical SMILES for 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide is O=C(Nc1ccc(-c2csc(-c3ncco3)c2)cc1)c1c(F)cccc1F.
What is the InChIKey of 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide?
The InChIKey is ONUMOWYRZRJYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F2N2O2S/c21-15-2-1-3-16(22)18(15)19(25)24-14-6-4-12(5-7-14)13-10-17(27-11-13)20-23-8-9-26-20/h1-11H,(H,24,25).
What are the key properties of 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide?
2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide has a molecular weight of 382.39 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-N-[4-[5-(1,3-oxazol-2-yl)thiophen-3-yl]phenyl]benzamide is sourced from PubChem (CID 24875776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).