C24H26F2N2O3 — CID 89022885
methyl N-[(Z)-4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-3-ethenylhex-3-enyl]-N-methylcarbamate (PubChem CID 89022885) has the molecular formula C24H26F2N2O3 and a molecular weight of 428.48 g/mol. Its IUPAC name is methyl N-[(Z)-4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-3-ethenylhex-3-enyl]-N-methylcarbamate.
| Compound Name | methyl N-[(Z)-4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-3-ethenylhex-3-enyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 89022885 |
| Molecular Formula | C24H26F2N2O3 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl N-[(Z)-4-[4-[(2,6-difluorobenzoyl)amino]phenyl]-3-ethenylhex-3-enyl]-N-methylcarbamate |
| SMILES | C=C/C(CCN(C)C(=O)OC)=C(/CC)c1ccc(NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C24H26F2N2O3/c1-5-16(14-15-28(3)24(30)31-4)19(6-2)17-10-12-18(13-11-17)27-23(29)22-20(25)8-7-9-21(22)26/h5,7-13H,1,6,14-15H2,2-4H3,(H,27,29)/b19-16+ |
| InChIKey | KKHHZNRDDCBCBM-KNTRCKAVSA-N |
| XLogP | 5.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|