C23H16F2N2O — CID 46376177
2,6-difluoro-N-[4-(6-methylquinolin-2-yl)phenyl]benzamide (PubChem CID 46376177) has the molecular formula C23H16F2N2O and a molecular weight of 374.39 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-(6-methylquinolin-2-yl)phenyl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-(6-methylquinolin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 46376177 |
| Molecular Formula | C23H16F2N2O |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2,6-difluoro-N-[4-(6-methylquinolin-2-yl)phenyl]benzamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)c4c(F)cccc4F)cc3)ccc2c1 |
| InChI | InChI=1S/C23H16F2N2O/c1-14-5-11-21-16(13-14)8-12-20(27-21)15-6-9-17(10-7-15)26-23(28)22-18(24)3-2-4-19(22)25/h2-13H,1H3,(H,26,28) |
| InChIKey | GSVSMGYSDLRKTR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |