C25H21F2NO2 — CID 87056899
2,6-difluoro-N-[4-(2,2,6-trimethylchromen-4-yl)phenyl]benzamide (PubChem CID 87056899) has the molecular formula C25H21F2NO2 and a molecular weight of 405.44 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-(2,2,6-trimethylchromen-4-yl)phenyl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-(2,2,6-trimethylchromen-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 87056899 |
| Molecular Formula | C25H21F2NO2 |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2,6-difluoro-N-[4-(2,2,6-trimethylchromen-4-yl)phenyl]benzamide |
| SMILES | Cc1ccc2c(c1)C(c1ccc(NC(=O)c3c(F)cccc3F)cc1)=CC(C)(C)O2 |
| InChI | InChI=1S/C25H21F2NO2/c1-15-7-12-22-18(13-15)19(14-25(2,3)30-22)16-8-10-17(11-9-16)28-24(29)23-20(26)5-4-6-21(23)27/h4-14H,1-3H3,(H,28,29) |
| InChIKey | ZHVJVOSPEHEZAV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |