C19H16F2O3 — CID 58406516
methyl 4-(2,6-difluorophenyl)-2,2-dimethylchromene-6-carboxylate (PubChem CID 58406516) has the molecular formula C19H16F2O3 and a molecular weight of 330.33 g/mol. Its IUPAC name is methyl 4-(2,6-difluorophenyl)-2,2-dimethylchromene-6-carboxylate.
| Compound Name | methyl 4-(2,6-difluorophenyl)-2,2-dimethylchromene-6-carboxylate |
|---|---|
| PubChem CID | 58406516 |
| Molecular Formula | C19H16F2O3 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl 4-(2,6-difluorophenyl)-2,2-dimethylchromene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(c1c(F)cccc1F)=CC(C)(C)O2 |
| InChI | InChI=1S/C19H16F2O3/c1-19(2)10-13(17-14(20)5-4-6-15(17)21)12-9-11(18(22)23-3)7-8-16(12)24-19/h4-10H,1-3H3 |
| InChIKey | HKVWOBGYSMLNRY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |