C13H15NO4 — CID 142688065
methyl 4-hydroxyimino-2,2-dimethyl-3H-chromene-6-carboxylate (PubChem CID 142688065) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 4-hydroxyimino-2,2-dimethyl-3H-chromene-6-carboxylate.
| Compound Name | methyl 4-hydroxyimino-2,2-dimethyl-3H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 142688065 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 4-hydroxyimino-2,2-dimethyl-3H-chromene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=NO)CC(C)(C)O2 |
| InChI | InChI=1S/C13H15NO4/c1-13(2)7-10(14-16)9-6-8(12(15)17-3)4-5-11(9)18-13/h4-6,16H,7H2,1-3H3 |
| InChIKey | WKMLTKHXIJFYKF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|